C28H32N8O6 — CID 91451712
5-amino-1-benzylimidazole-4-carboxamide;9-benzyl-3H-purine-2,6-dione;diethyl carbonate (PubChem CID 91451712) has the molecular formula C28H32N8O6 and a molecular weight of 576.61 g/mol. Its IUPAC name is 5-amino-1-benzylimidazole-4-carboxamide;9-benzyl-3H-purine-2,6-dione;diethyl carbonate.
| Compound Name | 5-amino-1-benzylimidazole-4-carboxamide;9-benzyl-3H-purine-2,6-dione;diethyl carbonate |
|---|---|
| PubChem CID | 91451712 |
| Molecular Formula | C28H32N8O6 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 5-amino-1-benzylimidazole-4-carboxamide;9-benzyl-3H-purine-2,6-dione;diethyl carbonate |
| SMILES | CCOC(=O)OCC.NC(=O)c1ncn(Cc2ccccc2)c1N.O=c1[nH]c(=O)c2ncn(Cc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C12H10N4O2.C11H12N4O.C5H10O3/c17-11-9-10(14-12(18)15-11)16(7-13-9)6-8-4-2-1-3-5-8;12-10-9(11(13)16)14-7-15(10)6-8-4-2-1-3-5-8;1-3-7-5(6)8-4-2/h1-5,7H,6H2,(H2,14,15,17,18);1-5,7H,6,12H2,(H2,13,16);3-4H2,1-2H3 |
| InChIKey | BUZUATXOTHKKNB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 206.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |