C23H28N2O5 — CID 9145193
4-hexoxy-3-methoxy-N-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]benzamide (PubChem CID 9145193) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-hexoxy-3-methoxy-N-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]benzamide.
| Compound Name | 4-hexoxy-3-methoxy-N-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]benzamide |
|---|---|
| PubChem CID | 9145193 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-hexoxy-3-methoxy-N-[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc3c(c2)NC(=O)[C@@H](C)O3)cc1OC |
| InChI | InChI=1S/C23H28N2O5/c1-4-5-6-7-12-29-20-10-8-16(13-21(20)28-3)23(27)24-17-9-11-19-18(14-17)25-22(26)15(2)30-19/h8-11,13-15H,4-7,12H2,1-3H3,(H,24,27)(H,25,26)/t15-/m1/s1 |
| InChIKey | REEGXDGVJBANOD-OAHLLOKOSA-N |
| XLogP | 4.63 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|