C24H25ClN4O4 — CID 91452367
N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-5-[4-chloro-2-(dihydroxyamino)phenyl]furan-2-carboxamide (PubChem CID 91452367) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-5-[4-chloro-2-(dihydroxyamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-5-[4-chloro-2-(dihydroxyamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91452367 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-5-[4-chloro-2-(dihydroxyamino)phenyl]furan-2-carboxamide |
| SMILES | CN1C[C@@H]2CCN(c3ccc(NC(=O)c4ccc(-c5ccc(Cl)cc5N(O)O)o4)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C24H25ClN4O4/c1-27-13-15-10-11-28(21(15)14-27)18-5-3-17(4-6-18)26-24(30)23-9-8-22(33-23)19-7-2-16(25)12-20(19)29(31)32/h2-9,12,15,21,31-32H,10-11,13-14H2,1H3,(H,26,30)/t15-,21+/m0/s1 |
| InChIKey | IUCNFTKOQUKUST-YCRPNKLZSA-N |
| XLogP | 4.58 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|