About 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide
11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide (PubChem CID 91452530) has the molecular formula C15H12N-
and a molecular weight of 206.27 g/mol. Its IUPAC name is 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide.
Molecular Properties
| Compound Name | 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide |
| PubChem CID | 91452530 |
| Molecular Formula | C15H12N- |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide |
| SMILES | Cc1c2c(nc3ccccc13)=CC=[C-]CC=2 |
| InChI | InChI=1S/C15H12N/c1-11-12-7-3-2-4-9-14(12)16-15-10-6-5-8-13(11)15/h4-10H,3H2,1H3/q-1 |
| InChIKey | ZSMAFQKBPYNRMV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide?
The IUPAC name of 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide (CID 91452530) is 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide.
What is the SMILES notation for 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide?
The canonical SMILES for 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide is Cc1c2c(nc3ccccc13)=CC=[C-]CC=2.
What is the InChIKey of 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide?
The InChIKey is ZSMAFQKBPYNRMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N/c1-11-12-7-3-2-4-9-14(12)16-15-10-6-5-8-13(11)15/h4-10H,3H2,1H3/q-1.
What are the key properties of 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide?
11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide has a molecular weight of 206.27 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-8,9-dihydrocyclohepta[b]quinolin-8-ide is sourced from PubChem (CID 91452530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).