About 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid
2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid (PubChem CID 91452655) has the molecular formula C20H21N3O5
and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid |
| PubChem CID | 91452655 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(COc2ccc(CC3COC(=O)N3CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O5/c21-19(22)15-5-1-14(2-6-15)11-27-17-7-3-13(4-8-17)9-16-12-28-20(26)23(16)10-18(24)25/h1-8,16H,9-12H2,(H3,21,22)(H,24,25) |
| InChIKey | ONWVEUIRPFDORA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid?
The IUPAC name of 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid (CID 91452655) is 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid.
What is the SMILES notation for 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid?
The canonical SMILES for 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid is [H]/N=C(\N)c1ccc(COc2ccc(CC3COC(=O)N3CC(=O)O)cc2)cc1.
What is the InChIKey of 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid?
The InChIKey is ONWVEUIRPFDORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O5/c21-19(22)15-5-1-14(2-6-15)11-27-17-7-3-13(4-8-17)9-16-12-28-20(26)23(16)10-18(24)25/h1-8,16H,9-12H2,(H3,21,22)(H,24,25).
What are the key properties of 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid?
2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid has a molecular weight of 383.40 g/mol, XLogP of 2.00, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[4-[(4-carbamimidoylphenyl)methoxy]phenyl]methyl]-2-oxo-1,3-oxazolidin-3-yl]acetic acid is sourced from PubChem (CID 91452655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).