C29H54O6 — CID 91453066
2-butan-2-yloxycarbonylcyclohexane-1-carboxylic acid;dodecyl 2-methylbutanoate (PubChem CID 91453066) has the molecular formula C29H54O6 and a molecular weight of 498.75 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonylcyclohexane-1-carboxylic acid;dodecyl 2-methylbutanoate.
| Compound Name | 2-butan-2-yloxycarbonylcyclohexane-1-carboxylic acid;dodecyl 2-methylbutanoate |
|---|---|
| PubChem CID | 91453066 |
| Molecular Formula | C29H54O6 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | 2-butan-2-yloxycarbonylcyclohexane-1-carboxylic acid;dodecyl 2-methylbutanoate |
| SMILES | CCC(C)OC(=O)C1CCCCC1C(=O)O.CCCCCCCCCCCCOC(=O)C(C)CC |
| InChI | InChI=1S/C17H34O2.C12H20O4/c1-4-6-7-8-9-10-11-12-13-14-15-19-17(18)16(3)5-2;1-3-8(2)16-12(15)10-7-5-4-6-9(10)11(13)14/h16H,4-15H2,1-3H3;8-10H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | HEQKVMLVCUXFDV-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|