C21H24F3N3O3 — CID 91453290
3-(4-ethylideneoct-5-en-3-ylamino)-4-[[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 91453290) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is 3-(4-ethylideneoct-5-en-3-ylamino)-4-[[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-ethylideneoct-5-en-3-ylamino)-4-[[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 91453290 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-(4-ethylideneoct-5-en-3-ylamino)-4-[[2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC=C(C=CCC)C(CC)Nc1c(Nc2cccn(CC(F)(F)F)c2=O)c(=O)c1=O |
| InChI | InChI=1S/C21H24F3N3O3/c1-4-7-9-13(5-2)14(6-3)25-16-17(19(29)18(16)28)26-15-10-8-11-27(20(15)30)12-21(22,23)24/h5,7-11,14,25-26H,4,6,12H2,1-3H3 |
| InChIKey | FZTSSHDJZKXENA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|