About ethane;methyl trifluoromethanesulfonate;quinoline
ethane;methyl trifluoromethanesulfonate;quinoline (PubChem CID 91453882) has the molecular formula C13H16F3NO3S
and a molecular weight of 323.34 g/mol. Its IUPAC name is ethane;methyl trifluoromethanesulfonate;quinoline.
Molecular Properties
| Compound Name | ethane;methyl trifluoromethanesulfonate;quinoline |
| PubChem CID | 91453882 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | ethane;methyl trifluoromethanesulfonate;quinoline |
| SMILES | CC.COS(=O)(=O)C(F)(F)F.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H3F3O3S.C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-8-9(6,7)2(3,4)5;1-2/h1-7H;1H3;1-2H3 |
| InChIKey | NWRQOMADHTUDPS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl trifluoromethanesulfonate;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl trifluoromethanesulfonate;quinoline?
The IUPAC name of ethane;methyl trifluoromethanesulfonate;quinoline (CID 91453882) is ethane;methyl trifluoromethanesulfonate;quinoline.
What is the SMILES notation for ethane;methyl trifluoromethanesulfonate;quinoline?
The canonical SMILES for ethane;methyl trifluoromethanesulfonate;quinoline is CC.COS(=O)(=O)C(F)(F)F.c1ccc2ncccc2c1.
What is the InChIKey of ethane;methyl trifluoromethanesulfonate;quinoline?
The InChIKey is NWRQOMADHTUDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H3F3O3S.C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-8-9(6,7)2(3,4)5;1-2/h1-7H;1H3;1-2H3.
What are the key properties of ethane;methyl trifluoromethanesulfonate;quinoline?
ethane;methyl trifluoromethanesulfonate;quinoline has a molecular weight of 323.34 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl trifluoromethanesulfonate;quinoline is sourced from PubChem (CID 91453882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).