C12HBr2F7S — CID 91453915
2,5-dibromo-3-[1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene (PubChem CID 91453915) has the molecular formula C12HBr2F7S and a molecular weight of 470.00 g/mol. Its IUPAC name is 2,5-dibromo-3-[1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene.
| Compound Name | 2,5-dibromo-3-[1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene |
|---|---|
| PubChem CID | 91453915 |
| Molecular Formula | C12HBr2F7S |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 467.81 |
| IUPAC Name | 2,5-dibromo-3-[1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]thiophene |
| SMILES | FC(=C(F)c1c(F)c(F)c(F)c(F)c1F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12HBr2F7S/c13-3-1-2(12(14)22-3)5(15)6(16)4-7(17)9(19)11(21)10(20)8(4)18/h1H |
| InChIKey | BYCUOIBGUHXCNR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|