About 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane
3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane (PubChem CID 91454508) has the molecular formula C21H35NO2
and a molecular weight of 333.52 g/mol. Its IUPAC name is 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane.
Molecular Properties
| Compound Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane |
| PubChem CID | 91454508 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane |
| SMILES | CC.CC.Cc1cc(C)n(C)c(=O)c1C(=O)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C17H23NO2.2C2H6/c1-12-11-13(2)18(3)17(20)16(12)15(19)10-9-14-7-5-4-6-8-14;2*1-2/h9-11,14H,4-8H2,1-3H3;2*1-2H3/b10-9+;; |
| InChIKey | QYSVQEXVGRANDK-TTWKNDKESA-N |
| XLogP | 5.37 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane?
The IUPAC name of 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane (CID 91454508) is 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane.
What is the SMILES notation for 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane?
The canonical SMILES for 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane is CC.CC.Cc1cc(C)n(C)c(=O)c1C(=O)/C=C/C1CCCCC1.
What is the InChIKey of 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane?
The InChIKey is QYSVQEXVGRANDK-TTWKNDKESA-N. The full InChI is InChI=1S/C17H23NO2.2C2H6/c1-12-11-13(2)18(3)17(20)16(12)15(19)10-9-14-7-5-4-6-8-14;2*1-2/h9-11,14H,4-8H2,1-3H3;2*1-2H3/b10-9+;;.
What are the key properties of 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane?
3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane has a molecular weight of 333.52 g/mol, XLogP of 5.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane is sourced from PubChem (CID 91454508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).