C22H23N7O — CID 91454879
1-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 91454879) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 91454879 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | COc1cccc(-n2ncc3c(/N=N/Cc4ccc(CN(C)C)cc4)ncnc32)c1 |
| InChI | InChI=1S/C22H23N7O/c1-28(2)14-17-9-7-16(8-10-17)12-25-27-21-20-13-26-29(22(20)24-15-23-21)18-5-4-6-19(11-18)30-3/h4-11,13,15H,12,14H2,1-3H3/b27-25+ |
| InChIKey | LKWMJQPCSIFXNT-IMVLJIQESA-N |
| XLogP | 4.17 |
| TPSA | 80.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|