C23H29NO6 — CID 91454897
tert-butyl (2S)-2-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]piperidine-1-carboxylate (PubChem CID 91454897) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91454897 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | tert-butyl (2S)-2-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)C1C(=O)O[C@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H29NO6/c1-23(2,3)30-22(28)24-14-8-7-11-16(24)19(25)18-20(26)17(29-21(18)27)13-12-15-9-5-4-6-10-15/h4-6,9-10,16-18H,7-8,11-14H2,1-3H3/t16-,17+,18?/m0/s1 |
| InChIKey | BNWLYSHSFSZUNZ-MYFVLZFPSA-N |
| XLogP | 3.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|