C17H15N5O — CID 91455087
3-[(4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91455087) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[(4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91455087 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[(4,6-dimethyl-1H-pyrazolo[5,4-b]pyridin-3-yl)iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(C)c2c(/N=C/C3C(=O)Nc4ccccc43)n[nH]c2n1 |
| InChI | InChI=1S/C17H15N5O/c1-9-7-10(2)19-16-14(9)15(21-22-16)18-8-12-11-5-3-4-6-13(11)20-17(12)23/h3-8,12H,1-2H3,(H,20,23)(H,19,21,22)/b18-8+ |
| InChIKey | VOCHXDJKLWNHOX-QGMBQPNBSA-N |
| XLogP | 3.01 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|