About 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole
5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole (PubChem CID 91455147) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole.
Molecular Properties
| Compound Name | 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole |
| PubChem CID | 91455147 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole |
| SMILES | CC(C)C(C)CC1N=NNN1C |
| InChI | InChI=1S/C8H18N4/c1-6(2)7(3)5-8-9-10-11-12(8)4/h6-8H,5H2,1-4H3,(H,9,11) |
| InChIKey | WGFJAMSUPUITAF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole?
The IUPAC name of 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole (CID 91455147) is 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole.
What is the SMILES notation for 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole?
The canonical SMILES for 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole is CC(C)C(C)CC1N=NNN1C.
What is the InChIKey of 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole?
The InChIKey is WGFJAMSUPUITAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-6(2)7(3)5-8-9-10-11-12(8)4/h6-8H,5H2,1-4H3,(H,9,11).
What are the key properties of 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole?
5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole has a molecular weight of 170.26 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dimethylbutyl)-1-methyl-2,5-dihydrotetrazole is sourced from PubChem (CID 91455147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).