C25H29NO2S2 — CID 91455469
4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-3H-1,3-thiazole-2-thione (PubChem CID 91455469) has the molecular formula C25H29NO2S2 and a molecular weight of 439.65 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-3H-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 91455469 |
| Molecular Formula | C25H29NO2S2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-hydroxy-5-[[4-methoxy-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]methyl]-3H-1,3-thiazole-2-thione |
| SMILES | COc1ccc(Cc2sc(=S)[nH]c2O)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H29NO2S2/c1-24(2)10-11-25(3,4)19-14-16(7-8-18(19)24)17-12-15(6-9-20(17)28-5)13-21-22(27)26-23(29)30-21/h6-9,12,14,27H,10-11,13H2,1-5H3,(H,26,29) |
| InChIKey | LQKZIYRSFKYFGL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|