C22H28BrCl2NO4 — CID 91455490
7-[(1S,2R)-2-[2-[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]ethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid (PubChem CID 91455490) has the molecular formula C22H28BrCl2NO4 and a molecular weight of 521.28 g/mol. Its IUPAC name is 7-[(1S,2R)-2-[2-[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]ethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2R)-2-[2-[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]ethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91455490 |
| Molecular Formula | C22H28BrCl2NO4 |
| Molecular Weight | 521.28 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 7-[(1S,2R)-2-[2-[2-(acetyloxymethyl)-6-chloro-4-pyridinyl]ethyl]-4-bromo-3-chlorocyclopentyl]hept-5-enoic acid |
| SMILES | CC(=O)OCc1cc(CC[C@H]2C(Cl)C(Br)C[C@@H]2CC=CCCCC(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C22H28BrCl2NO4/c1-14(27)30-13-17-10-15(11-20(24)26-17)8-9-18-16(12-19(23)22(18)25)6-4-2-3-5-7-21(28)29/h2,4,10-11,16,18-19,22H,3,5-9,12-13H2,1H3,(H,28,29)/t16-,18+,19?,22?/m0/s1 |
| InChIKey | MPWBZLALOICRNQ-LNXNTXSESA-N |
| XLogP | 5.94 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.28 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|