C11H20 — CID 91455933
1-(2,3-dimethylpent-1-enyl)-1-methylcyclopropane (PubChem CID 91455933) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 1-(2,3-dimethylpent-1-enyl)-1-methylcyclopropane.
| Compound Name | 1-(2,3-dimethylpent-1-enyl)-1-methylcyclopropane |
|---|---|
| PubChem CID | 91455933 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 1-(2,3-dimethylpent-1-enyl)-1-methylcyclopropane |
| SMILES | CCC(C)C(C)=CC1(C)CC1 |
| InChI | InChI=1S/C11H20/c1-5-9(2)10(3)8-11(4)6-7-11/h8-9H,5-7H2,1-4H3 |
| InChIKey | KWQMUHUZIVBMAF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|