C11H17NO — CID 91456149
2-ethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one (PubChem CID 91456149) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-ethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one.
| Compound Name | 2-ethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one |
|---|---|
| PubChem CID | 91456149 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-ethyl-4a,5,6,7,8,8a-hexahydro-3H-quinolin-4-one |
| SMILES | CCC1=NC2CCCCC2C(=O)C1 |
| InChI | InChI=1S/C11H17NO/c1-2-8-7-11(13)9-5-3-4-6-10(9)12-8/h9-10H,2-7H2,1H3 |
| InChIKey | UOCNYEXLKUFVPD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |