C22H23NO5 — CID 91456587
5-[2-(2,2-dimethylchromen-6-yl)-2-nitrosoethyl]-2,3-dimethoxybenzaldehyde (PubChem CID 91456587) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 5-[2-(2,2-dimethylchromen-6-yl)-2-nitrosoethyl]-2,3-dimethoxybenzaldehyde.
| Compound Name | 5-[2-(2,2-dimethylchromen-6-yl)-2-nitrosoethyl]-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 91456587 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 5-[2-(2,2-dimethylchromen-6-yl)-2-nitrosoethyl]-2,3-dimethoxybenzaldehyde |
| SMILES | COc1cc(CC(N=O)c2ccc3c(c2)C=CC(C)(C)O3)cc(C=O)c1OC |
| InChI | InChI=1S/C22H23NO5/c1-22(2)8-7-16-12-15(5-6-19(16)28-22)18(23-25)10-14-9-17(13-24)21(27-4)20(11-14)26-3/h5-9,11-13,18H,10H2,1-4H3 |
| InChIKey | MANZKOXDYJBUEB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|