C15H34Si — CID 91457425
trimethyl(4,5,6,6-tetramethyloctyl)silane (PubChem CID 91457425) has the molecular formula C15H34Si and a molecular weight of 242.52 g/mol. Its IUPAC name is trimethyl(4,5,6,6-tetramethyloctyl)silane.
| Compound Name | trimethyl(4,5,6,6-tetramethyloctyl)silane |
|---|---|
| PubChem CID | 91457425 |
| Molecular Formula | C15H34Si |
| Molecular Weight | 242.52 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | trimethyl(4,5,6,6-tetramethyloctyl)silane |
| SMILES | CCC(C)(C)C(C)C(C)CCC[Si](C)(C)C |
| InChI | InChI=1S/C15H34Si/c1-9-15(4,5)14(3)13(2)11-10-12-16(6,7)8/h13-14H,9-12H2,1-8H3 |
| InChIKey | URIOPGOPVJOAOC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|