C24H20F3N3O3S — CID 91457548
1-[(2-hydroxyphenyl)-pyridin-4-ylmethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione (PubChem CID 91457548) has the molecular formula C24H20F3N3O3S and a molecular weight of 487.50 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)-pyridin-4-ylmethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(2-hydroxyphenyl)-pyridin-4-ylmethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91457548 |
| Molecular Formula | C24H20F3N3O3S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-[(2-hydroxyphenyl)-pyridin-4-ylmethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc(SC(F)(F)F)cc2)C(=O)N1C(c1ccncc1)c1ccccc1O |
| InChI | InChI=1S/C24H20F3N3O3S/c1-23(2)21(32)29(16-7-9-17(10-8-16)34-24(25,26)27)22(33)30(23)20(15-11-13-28-14-12-15)18-5-3-4-6-19(18)31/h3-14,20,31H,1-2H3 |
| InChIKey | IETQQICKXPEPDK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|