About 5-chloro-1,2,4-triazine-3-sulfinate
5-chloro-1,2,4-triazine-3-sulfinate (PubChem CID 91457643) has the molecular formula C3HClN3O2S-
and a molecular weight of 178.58 g/mol. Its IUPAC name is 5-chloro-1,2,4-triazine-3-sulfinate.
Molecular Properties
| Compound Name | 5-chloro-1,2,4-triazine-3-sulfinate |
| PubChem CID | 91457643 |
| Molecular Formula | C3HClN3O2S- |
| Molecular Weight | 178.58 g/mol |
| Exact Mass | 177.95 |
| IUPAC Name | 5-chloro-1,2,4-triazine-3-sulfinate |
| SMILES | O=S([O-])c1nncc(Cl)n1 |
| InChI | InChI=1S/C3H2ClN3O2S/c4-2-1-5-7-3(6-2)10(8)9/h1H,(H,8,9)/p-1 |
| InChIKey | GQFUDPPUHTUQEH-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 78.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.58 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,2,4-triazine-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2,4-triazine-3-sulfinate?
The IUPAC name of 5-chloro-1,2,4-triazine-3-sulfinate (CID 91457643) is 5-chloro-1,2,4-triazine-3-sulfinate.
What is the SMILES notation for 5-chloro-1,2,4-triazine-3-sulfinate?
The canonical SMILES for 5-chloro-1,2,4-triazine-3-sulfinate is O=S([O-])c1nncc(Cl)n1.
What is the InChIKey of 5-chloro-1,2,4-triazine-3-sulfinate?
The InChIKey is GQFUDPPUHTUQEH-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H2ClN3O2S/c4-2-1-5-7-3(6-2)10(8)9/h1H,(H,8,9)/p-1.
What are the key properties of 5-chloro-1,2,4-triazine-3-sulfinate?
5-chloro-1,2,4-triazine-3-sulfinate has a molecular weight of 178.58 g/mol, XLogP of -0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2,4-triazine-3-sulfinate is sourced from PubChem (CID 91457643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).