About (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one
(2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one (PubChem CID 91458438) has the molecular formula C23H50O3Si2
and a molecular weight of 430.82 g/mol. Its IUPAC name is (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one.
Molecular Properties
| Compound Name | (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one |
| PubChem CID | 91458438 |
| Molecular Formula | C23H50O3Si2 |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one |
| SMILES | C[C@H](CCCC(=O)CCC[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O3Si2/c1-19(25-27(9,10)22(3,4)5)15-13-17-21(24)18-14-16-20(2)26-28(11,12)23(6,7)8/h19-20H,13-18H2,1-12H3/t19-,20+ |
| InChIKey | JOAZKYPDDWTAGI-BGYRXZFFSA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one?
The IUPAC name of (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one (CID 91458438) is (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one.
What is the SMILES notation for (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one?
The canonical SMILES for (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one is C[C@H](CCCC(=O)CCC[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one?
The InChIKey is JOAZKYPDDWTAGI-BGYRXZFFSA-N. The full InChI is InChI=1S/C23H50O3Si2/c1-19(25-27(9,10)22(3,4)5)15-13-17-21(24)18-14-16-20(2)26-28(11,12)23(6,7)8/h19-20H,13-18H2,1-12H3/t19-,20+.
What are the key properties of (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one?
(2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one has a molecular weight of 430.82 g/mol, XLogP of 7.72, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]undecan-6-one is sourced from PubChem (CID 91458438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).