C20H43N3O3 — CID 91458749
1-[4-[2-[2-hydroxybutyl(2-hydroxypropyl)amino]ethyl]piperazin-1-yl]heptan-2-ol (PubChem CID 91458749) has the molecular formula C20H43N3O3 and a molecular weight of 373.58 g/mol. Its IUPAC name is 1-[4-[2-[2-hydroxybutyl(2-hydroxypropyl)amino]ethyl]piperazin-1-yl]heptan-2-ol.
| Compound Name | 1-[4-[2-[2-hydroxybutyl(2-hydroxypropyl)amino]ethyl]piperazin-1-yl]heptan-2-ol |
|---|---|
| PubChem CID | 91458749 |
| Molecular Formula | C20H43N3O3 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | 1-[4-[2-[2-hydroxybutyl(2-hydroxypropyl)amino]ethyl]piperazin-1-yl]heptan-2-ol |
| SMILES | CCCCCC(O)CN1CCN(CCN(CC(C)O)CC(O)CC)CC1 |
| InChI | InChI=1S/C20H43N3O3/c1-4-6-7-8-20(26)17-22-12-9-21(10-13-22)11-14-23(15-18(3)24)16-19(25)5-2/h18-20,24-26H,4-17H2,1-3H3 |
| InChIKey | JXJHCIWPHTZOFC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|