C18H37N3O2 — CID 91459045
1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 91459045) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 91459045 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CC1(C)CC(ON2C(C)(C)CC(N)CC2(C)C)CC(C)(C)N1O |
| InChI | InChI=1S/C18H37N3O2/c1-15(2)11-14(12-16(3,4)20(15)22)23-21-17(5,6)9-13(19)10-18(21,7)8/h13-14,22H,9-12,19H2,1-8H3 |
| InChIKey | WCSNKSREOZKOEH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |