About 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid
1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid (PubChem CID 91459865) has the molecular formula C14H26NO5+
and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid |
| PubChem CID | 91459865 |
| Molecular Formula | C14H26NO5+ |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid |
| SMILES | CCC1(C(=O)O)CC[N+](C(=O)O)(C(C)(C)C)CCC1O |
| InChI | InChI=1S/C14H25NO5/c1-5-14(11(17)18)7-9-15(12(19)20,13(2,3)4)8-6-10(14)16/h10,16H,5-9H2,1-4H3,(H-,17,18,19,20)/p+1 |
| InChIKey | UAQKWGOYJVZWKF-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid?
The IUPAC name of 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid (CID 91459865) is 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid.
What is the SMILES notation for 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid?
The canonical SMILES for 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid is CCC1(C(=O)O)CC[N+](C(=O)O)(C(C)(C)C)CCC1O.
What is the InChIKey of 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid?
The InChIKey is UAQKWGOYJVZWKF-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H25NO5/c1-5-14(11(17)18)7-9-15(12(19)20,13(2,3)4)8-6-10(14)16/h10,16H,5-9H2,1-4H3,(H-,17,18,19,20)/p+1.
What are the key properties of 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid?
1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid has a molecular weight of 288.36 g/mol, XLogP of 1.92, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-ethyl-5-hydroxyazepan-1-ium-1,4-dicarboxylic acid is sourced from PubChem (CID 91459865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).