C27H36F2O4S — CID 91460180
5-[(2S)-5-but-2-enoxythian-2-yl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohex-3-en-1-yl]-1,3-dioxane (PubChem CID 91460180) has the molecular formula C27H36F2O4S and a molecular weight of 494.64 g/mol. Its IUPAC name is 5-[(2S)-5-but-2-enoxythian-2-yl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohex-3-en-1-yl]-1,3-dioxane.
| Compound Name | 5-[(2S)-5-but-2-enoxythian-2-yl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohex-3-en-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 91460180 |
| Molecular Formula | C27H36F2O4S |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 5-[(2S)-5-but-2-enoxythian-2-yl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohex-3-en-1-yl]-1,3-dioxane |
| SMILES | CC=CCOC1CC[C@@H](C2COC(C3CC=C(c4ccc(OCC)c(F)c4F)CC3)OC2)SC1 |
| InChI | InChI=1S/C27H36F2O4S/c1-3-5-14-31-21-10-13-24(34-17-21)20-15-32-27(33-16-20)19-8-6-18(7-9-19)22-11-12-23(30-4-2)26(29)25(22)28/h3,5-6,11-12,19-21,24,27H,4,7-10,13-17H2,1-2H3/t19?,20?,21?,24-,27?/m0/s1 |
| InChIKey | ZDOJTHHGXQNHAT-ULCRDSCMSA-N |
| XLogP | 6.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|