About N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen
N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen (PubChem CID 91460282) has the molecular formula C13H17NO4S2
and a molecular weight of 315.42 g/mol. Its IUPAC name is N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen.
Molecular Properties
| Compound Name | N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen |
| PubChem CID | 91460282 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen |
| SMILES | Cc1ccc(SC2(C(=O)NO)CCSCC2)cc1.O=O |
| InChI | InChI=1S/C13H17NO2S2.O2/c1-10-2-4-11(5-3-10)18-13(12(15)14-16)6-8-17-9-7-13;1-2/h2-5,16H,6-9H2,1H3,(H,14,15); |
| InChIKey | HIIKKQXBHPTNCH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen?
The IUPAC name of N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen (CID 91460282) is N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen.
What is the SMILES notation for N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen?
The canonical SMILES for N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen is Cc1ccc(SC2(C(=O)NO)CCSCC2)cc1.O=O.
What is the InChIKey of N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen?
The InChIKey is HIIKKQXBHPTNCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S2.O2/c1-10-2-4-11(5-3-10)18-13(12(15)14-16)6-8-17-9-7-13;1-2/h2-5,16H,6-9H2,1H3,(H,14,15);.
What are the key properties of N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen?
N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen has a molecular weight of 315.42 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-4-(4-methylphenyl)sulfanylthiane-4-carboxamide;molecular oxygen is sourced from PubChem (CID 91460282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).