C18H15F4NO — CID 91460333
2-[(4-ethylphenyl)methyl]-5-fluoro-7-(trifluoromethyl)isoindol-1-ol (PubChem CID 91460333) has the molecular formula C18H15F4NO and a molecular weight of 337.32 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-5-fluoro-7-(trifluoromethyl)isoindol-1-ol.
| Compound Name | 2-[(4-ethylphenyl)methyl]-5-fluoro-7-(trifluoromethyl)isoindol-1-ol |
|---|---|
| PubChem CID | 91460333 |
| Molecular Formula | C18H15F4NO |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-5-fluoro-7-(trifluoromethyl)isoindol-1-ol |
| SMILES | CCc1ccc(Cn2cc3cc(F)cc(C(F)(F)F)c3c2O)cc1 |
| InChI | InChI=1S/C18H15F4NO/c1-2-11-3-5-12(6-4-11)9-23-10-13-7-14(19)8-15(18(20,21)22)16(13)17(23)24/h3-8,10,24H,2,9H2,1H3 |
| InChIKey | SBWNKZDJCNNLST-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |