C26H46O4Si — CID 91460343
(3R,4R)-4-[(2R,6S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethyl-10-methylidene-7-oxododec-4-en-2-yl]-3-methyloxetan-2-one (PubChem CID 91460343) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is (3R,4R)-4-[(2R,6S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethyl-10-methylidene-7-oxododec-4-en-2-yl]-3-methyloxetan-2-one.
| Compound Name | (3R,4R)-4-[(2R,6S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethyl-10-methylidene-7-oxododec-4-en-2-yl]-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 91460343 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | (3R,4R)-4-[(2R,6S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,6,8-trimethyl-10-methylidene-7-oxododec-4-en-2-yl]-3-methyloxetan-2-one |
| SMILES | C=C(CC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)[C@@H](C)C=C(C)C[C@@H](C)[C@H]1OC(=O)[C@@H]1C |
| InChI | InChI=1S/C26H46O4Si/c1-13-17(3)24(30-31(11,12)26(8,9)10)20(6)22(27)18(4)14-16(2)15-19(5)23-21(7)25(28)29-23/h14,18-21,23-24H,3,13,15H2,1-2,4-12H3/t18-,19+,20-,21+,23+,24-/m0/s1 |
| InChIKey | HWSHSXBVZNDASO-KSSSERLJSA-N |
| XLogP | 6.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|