About oxathiete 2,2-dioxide
oxathiete 2,2-dioxide (PubChem CID 91460450) has the molecular formula C2H2O3S
and a molecular weight of 106.10 g/mol. Its IUPAC name is oxathiete 2,2-dioxide.
Molecular Properties
| Compound Name | oxathiete 2,2-dioxide |
| PubChem CID | 91460450 |
| Molecular Formula | C2H2O3S |
| Molecular Weight | 106.10 g/mol |
| Exact Mass | 105.97 |
| IUPAC Name | oxathiete 2,2-dioxide |
| SMILES | O=S1(=O)C=CO1 |
| InChI | InChI=1S/C2H2O3S/c3-6(4)2-1-5-6/h1-2H |
| InChIKey | AHPNUFKQMYZYFP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.10 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze oxathiete 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxathiete 2,2-dioxide?
The IUPAC name of oxathiete 2,2-dioxide (CID 91460450) is oxathiete 2,2-dioxide.
What is the SMILES notation for oxathiete 2,2-dioxide?
The canonical SMILES for oxathiete 2,2-dioxide is O=S1(=O)C=CO1.
What is the InChIKey of oxathiete 2,2-dioxide?
The InChIKey is AHPNUFKQMYZYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O3S/c3-6(4)2-1-5-6/h1-2H.
What are the key properties of oxathiete 2,2-dioxide?
oxathiete 2,2-dioxide has a molecular weight of 106.10 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxathiete 2,2-dioxide is sourced from PubChem (CID 91460450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).