C11H15F6N — CID 91460499
8,8,8-trifluoro-N,7-dimethyl-5-(trifluoromethyl)octa-3,5-dien-2-amine (PubChem CID 91460499) has the molecular formula C11H15F6N and a molecular weight of 275.24 g/mol. Its IUPAC name is 8,8,8-trifluoro-N,7-dimethyl-5-(trifluoromethyl)octa-3,5-dien-2-amine.
| Compound Name | 8,8,8-trifluoro-N,7-dimethyl-5-(trifluoromethyl)octa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 91460499 |
| Molecular Formula | C11H15F6N |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 8,8,8-trifluoro-N,7-dimethyl-5-(trifluoromethyl)octa-3,5-dien-2-amine |
| SMILES | CNC(C)C=CC(=CC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F6N/c1-7(10(12,13)14)6-9(11(15,16)17)5-4-8(2)18-3/h4-8,18H,1-3H3 |
| InChIKey | NRBHRHPMWUDGDE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|