C20H19NO2 — CID 91460795
3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carbaldehyde (PubChem CID 91460795) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carbaldehyde.
| Compound Name | 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carbaldehyde |
|---|---|
| PubChem CID | 91460795 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3,3-dimethyl-1-phenacyl-4H-isoquinoline-6-carbaldehyde |
| SMILES | CC1(C)Cc2cc(C=O)ccc2C(CC(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H19NO2/c1-20(2)12-16-10-14(13-22)8-9-17(16)18(21-20)11-19(23)15-6-4-3-5-7-15/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | FSMAHDWAQPNHFR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|