C40H73NO11 — CID 91461185
6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-7-methoxy-4-(4-methoxy-4,5,6-trimethyloxan-2-yl)oxy-3,5,7,9,11,13-hexamethyl-10-methylidene-oxacyclotetradecan-2-one (PubChem CID 91461185) has the molecular formula C40H73NO11 and a molecular weight of 744.02 g/mol. Its IUPAC name is 6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-7-methoxy-4-(4-methoxy-4,5,6-trimethyloxan-2-yl)oxy-3,5,7,9,11,13-hexamethyl-10-methylidene-oxacyclotetradecan-2-one.
| Compound Name | 6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-7-methoxy-4-(4-methoxy-4,5,6-trimethyloxan-2-yl)oxy-3,5,7,9,11,13-hexamethyl-10-methylidene-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 91461185 |
| Molecular Formula | C40H73NO11 |
| Molecular Weight | 744.02 g/mol |
| Exact Mass | 743.52 |
| IUPAC Name | 6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-12,13-dihydroxy-7-methoxy-4-(4-methoxy-4,5,6-trimethyloxan-2-yl)oxy-3,5,7,9,11,13-hexamethyl-10-methylidene-oxacyclotetradecan-2-one |
| SMILES | C=C1C(C)CC(C)(OC)C(OC2OC(C)CC(N(C)C)C2O)C(C)C(OC2CC(C)(OC)C(C)C(C)O2)C(C)C(=O)OC(CC)C(C)(O)C(O)C1C |
| InChI | InChI=1S/C40H73NO11/c1-17-30-40(12,45)34(43)24(5)23(4)21(2)19-39(11,47-16)35(52-37-32(42)29(41(13)14)18-22(3)48-37)25(6)33(26(7)36(44)50-30)51-31-20-38(10,46-15)27(8)28(9)49-31/h21-22,24-35,37,42-43,45H,4,17-20H2,1-3,5-16H3 |
| InChIKey | UBUCGHNWQIUVRM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.02 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|