C6H8F5N — CID 91461386
1,1,1,2,2-pentafluoro-N-methylpentan-3-imine (PubChem CID 91461386) has the molecular formula C6H8F5N and a molecular weight of 189.13 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-N-methylpentan-3-imine.
| Compound Name | 1,1,1,2,2-pentafluoro-N-methylpentan-3-imine |
|---|---|
| PubChem CID | 91461386 |
| Molecular Formula | C6H8F5N |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-N-methylpentan-3-imine |
| SMILES | CC/C(=N\C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5N/c1-3-4(12-2)5(7,8)6(9,10)11/h3H2,1-2H3/b12-4+ |
| InChIKey | UBXNPANKIOWDNF-UUILKARUSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|