C10H14F6O2Si — CID 91461803
1-[di(propan-2-yl)-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone (PubChem CID 91461803) has the molecular formula C10H14F6O2Si and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-[di(propan-2-yl)-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[di(propan-2-yl)-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 91461803 |
| Molecular Formula | C10H14F6O2Si |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-[di(propan-2-yl)-(2,2,2-trifluoroacetyl)silyl]-2,2,2-trifluoroethanone |
| SMILES | CC(C)[Si](C(=O)C(F)(F)F)(C(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H14F6O2Si/c1-5(2)19(6(3)4,7(17)9(11,12)13)8(18)10(14,15)16/h5-6H,1-4H3 |
| InChIKey | TYCAWUZNNOHJGR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|