C24H32BrN3O2 — CID 91462634
(1S,2R,3R,4R)-2-(4-bromophenyl)-3-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 91462634) has the molecular formula C24H32BrN3O2 and a molecular weight of 474.44 g/mol. Its IUPAC name is (1S,2R,3R,4R)-2-(4-bromophenyl)-3-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1S,2R,3R,4R)-2-(4-bromophenyl)-3-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 91462634 |
| Molecular Formula | C24H32BrN3O2 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (1S,2R,3R,4R)-2-(4-bromophenyl)-3-[5-(dimethylamino)pentyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CN(C)CCCCC[C@@]1(C(N)=O)[C@@H]2C=C[C@@H](C23CC3)[C@@]1(C(N)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H32BrN3O2/c1-28(2)15-5-3-4-12-23(20(26)29)18-10-11-19(22(18)13-14-22)24(23,21(27)30)16-6-8-17(25)9-7-16/h6-11,18-19H,3-5,12-15H2,1-2H3,(H2,26,29)(H2,27,30)/t18-,19+,23+,24-/m1/s1 |
| InChIKey | RKHHGUPEYDVSFK-RJADORODSA-N |
| XLogP | 3.36 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|