C9H13F5O2 — CID 91462725
1-(2-ethenoxyethoxy)-1,1,2,2,2-pentafluoroethane;prop-1-ene (PubChem CID 91462725) has the molecular formula C9H13F5O2 and a molecular weight of 248.19 g/mol. Its IUPAC name is 1-(2-ethenoxyethoxy)-1,1,2,2,2-pentafluoroethane;prop-1-ene.
| Compound Name | 1-(2-ethenoxyethoxy)-1,1,2,2,2-pentafluoroethane;prop-1-ene |
|---|---|
| PubChem CID | 91462725 |
| Molecular Formula | C9H13F5O2 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(2-ethenoxyethoxy)-1,1,2,2,2-pentafluoroethane;prop-1-ene |
| SMILES | C=CC.C=COCCOC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F5O2.C3H6/c1-2-12-3-4-13-6(10,11)5(7,8)9;1-3-2/h2H,1,3-4H2;3H,1H2,2H3 |
| InChIKey | ZYDOAUIYEYWPRG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|