C21H16ClFN6O — CID 91462781
3-[4-amino-6-[(2-chloroquinolin-3-yl)methylamino]pyrimidine-5-carboximidoyl]-5-fluorophenol (PubChem CID 91462781) has the molecular formula C21H16ClFN6O and a molecular weight of 422.85 g/mol. Its IUPAC name is 3-[4-amino-6-[(2-chloroquinolin-3-yl)methylamino]pyrimidine-5-carboximidoyl]-5-fluorophenol.
| Compound Name | 3-[4-amino-6-[(2-chloroquinolin-3-yl)methylamino]pyrimidine-5-carboximidoyl]-5-fluorophenol |
|---|---|
| PubChem CID | 91462781 |
| Molecular Formula | C21H16ClFN6O |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 3-[4-amino-6-[(2-chloroquinolin-3-yl)methylamino]pyrimidine-5-carboximidoyl]-5-fluorophenol |
| SMILES | [H]/N=C(\c1cc(O)cc(F)c1)c1c(N)ncnc1NCc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C21H16ClFN6O/c22-19-13(5-11-3-1-2-4-16(11)29-19)9-26-21-17(20(25)27-10-28-21)18(24)12-6-14(23)8-15(30)7-12/h1-8,10,24,30H,9H2,(H3,25,26,27,28)/b24-18+ |
| InChIKey | IXBYACLMPHEKLV-HKOYGPOVSA-N |
| XLogP | 4.13 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|