C21H16 — CID 91462786
pentacyclo[11.7.1.02,11.03,8.017,21]henicosa-1(21),4,6,8,10,12,14,16,19-nonaene (PubChem CID 91462786) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is pentacyclo[11.7.1.02,11.03,8.017,21]henicosa-1(21),4,6,8,10,12,14,16,19-nonaene.
| Compound Name | pentacyclo[11.7.1.02,11.03,8.017,21]henicosa-1(21),4,6,8,10,12,14,16,19-nonaene |
|---|---|
| PubChem CID | 91462786 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | pentacyclo[11.7.1.02,11.03,8.017,21]henicosa-1(21),4,6,8,10,12,14,16,19-nonaene |
| SMILES | C1=CC2=CC=C3C=c4cccc5c4=C(C=CC5)C3C2C=C1 |
| InChI | InChI=1S/C21H16/c1-2-9-18-14(5-1)11-12-17-13-16-8-3-6-15-7-4-10-19(20(15)16)21(17)18/h1-6,8-13,18,21H,7H2 |
| InChIKey | UTWBBZDXELBKHF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |