C25H43N7O3 — CID 91463133
N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide (PubChem CID 91463133) has the molecular formula C25H43N7O3 and a molecular weight of 489.67 g/mol. Its IUPAC name is N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide.
| Compound Name | N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 91463133 |
| Molecular Formula | C25H43N7O3 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide |
| SMILES | CCNC(=O)N/C(=N\C(CC(C)C)C(=O)NC1(C#N)CCN(C2CCCCC2)C1)N1CCOCC1 |
| InChI | InChI=1S/C25H43N7O3/c1-4-27-24(34)29-23(31-12-14-35-15-13-31)28-21(16-19(2)3)22(33)30-25(17-26)10-11-32(18-25)20-8-6-5-7-9-20/h19-21H,4-16,18H2,1-3H3,(H,30,33)(H2,27,28,29,34) |
| InChIKey | OIZKVFXRFZCGSH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|