C11H17B2N3O4 — CID 91463181
N-methyl-1-oxoboranylmethanamine;2-(oxoboranylmethylamino)-3-pyridin-3-ylpropanoic acid (PubChem CID 91463181) has the molecular formula C11H17B2N3O4 and a molecular weight of 276.90 g/mol. Its IUPAC name is N-methyl-1-oxoboranylmethanamine;2-(oxoboranylmethylamino)-3-pyridin-3-ylpropanoic acid.
| Compound Name | N-methyl-1-oxoboranylmethanamine;2-(oxoboranylmethylamino)-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 91463181 |
| Molecular Formula | C11H17B2N3O4 |
| Molecular Weight | 276.90 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-methyl-1-oxoboranylmethanamine;2-(oxoboranylmethylamino)-3-pyridin-3-ylpropanoic acid |
| SMILES | CNCB=O.O=BCNC(Cc1cccnc1)C(=O)O |
| InChI | InChI=1S/C9H11BN2O3.C2H6BNO/c13-9(14)8(12-6-10-15)4-7-2-1-3-11-5-7;1-4-2-3-5/h1-3,5,8,12H,4,6H2,(H,13,14);4H,2H2,1H3 |
| InChIKey | OQUCENUNWJKYDN-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.90 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|