About 5-propylsulfonyl-1H-1,2,4-triazol-3-amine
5-propylsulfonyl-1H-1,2,4-triazol-3-amine (PubChem CID 9146329) has the molecular formula C5H10N4O2S
and a molecular weight of 190.23 g/mol. Its IUPAC name is 5-propylsulfonyl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-propylsulfonyl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 9146329 |
| Molecular Formula | C5H10N4O2S |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 5-propylsulfonyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCCS(=O)(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C5H10N4O2S/c1-2-3-12(10,11)5-7-4(6)8-9-5/h2-3H2,1H3,(H3,6,7,8,9) |
| InChIKey | YHRZNUHIIXKQFC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-propylsulfonyl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propylsulfonyl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-propylsulfonyl-1H-1,2,4-triazol-3-amine (CID 9146329) is 5-propylsulfonyl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-propylsulfonyl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-propylsulfonyl-1H-1,2,4-triazol-3-amine is CCCS(=O)(=O)c1nc(N)n[nH]1.
What is the InChIKey of 5-propylsulfonyl-1H-1,2,4-triazol-3-amine?
The InChIKey is YHRZNUHIIXKQFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O2S/c1-2-3-12(10,11)5-7-4(6)8-9-5/h2-3H2,1H3,(H3,6,7,8,9).
What are the key properties of 5-propylsulfonyl-1H-1,2,4-triazol-3-amine?
5-propylsulfonyl-1H-1,2,4-triazol-3-amine has a molecular weight of 190.23 g/mol, XLogP of -0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propylsulfonyl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 9146329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).