C35H57FO2Si — CID 91463323
(7S)-7-[(7aS)-4-[2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol (PubChem CID 91463323) has the molecular formula C35H57FO2Si and a molecular weight of 556.92 g/mol. Its IUPAC name is (7S)-7-[(7aS)-4-[2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol.
| Compound Name | (7S)-7-[(7aS)-4-[2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol |
|---|---|
| PubChem CID | 91463323 |
| Molecular Formula | C35H57FO2Si |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | (7S)-7-[(7aS)-4-[2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C([C@@H](C)CC=CC(O)(CC)CC)=CCC23)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C35H57FO2Si/c1-11-35(37,12-2)22-13-15-25(3)30-19-20-31-27(16-14-21-34(30,31)8)17-18-28-23-29(24-32(36)26(28)4)38-39(9,10)33(5,6)7/h13,17-19,22,25,29,31-32,37H,4,11-12,14-16,20-21,23-24H2,1-3,5-10H3/t25-,29+,31?,32-,34+/m0/s1 |
| InChIKey | DKQSKBHVAQFTFP-HXCKYGJKSA-N |
| XLogP | 10.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|