C24H20ClNO4S — CID 91463858
3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-ethenylphenoxy]propane-1-sulfonic acid (PubChem CID 91463858) has the molecular formula C24H20ClNO4S and a molecular weight of 453.95 g/mol. Its IUPAC name is 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-ethenylphenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-ethenylphenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91463858 |
| Molecular Formula | C24H20ClNO4S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-ethenylphenoxy]propane-1-sulfonic acid |
| SMILES | C=Cc1cc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)ccc1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C24H20ClNO4S/c1-2-19-16-18(5-13-24(19)30-14-3-15-31(27,28)29)4-11-23-12-8-21(17-26-23)20-6-9-22(25)10-7-20/h2,5-10,12-13,16-17H,1,3,14-15H2,(H,27,28,29) |
| InChIKey | COHQCAPAAXXXRI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|