C27H23N5O3 — CID 91463874
10-(1,3-benzodioxol-5-yl)-N-(2-pyrazol-1-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide (PubChem CID 91463874) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yl)-N-(2-pyrazol-1-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide.
| Compound Name | 10-(1,3-benzodioxol-5-yl)-N-(2-pyrazol-1-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 91463874 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yl)-N-(2-pyrazol-1-ylethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-3-carboxamide |
| SMILES | O=C(NCCn1cccn1)c1ccn2c1Cc1c([nH]c3ccccc13)C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H23N5O3/c33-27(28-10-13-31-11-3-9-29-31)19-8-12-32-22(19)15-20-18-4-1-2-5-21(18)30-25(20)26(32)17-6-7-23-24(14-17)35-16-34-23/h1-9,11-12,14,26,30H,10,13,15-16H2,(H,28,33) |
| InChIKey | TXVQXEJGBXFMAD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|