C29H37N5OS2 — CID 91463966
5-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]-N-(2,2-didiazenylethyl)thiophene-2-carboxamide (PubChem CID 91463966) has the molecular formula C29H37N5OS2 and a molecular weight of 535.78 g/mol. Its IUPAC name is 5-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]-N-(2,2-didiazenylethyl)thiophene-2-carboxamide.
| Compound Name | 5-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]-N-(2,2-didiazenylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91463966 |
| Molecular Formula | C29H37N5OS2 |
| Molecular Weight | 535.78 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 5-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]-N-(2,2-didiazenylethyl)thiophene-2-carboxamide |
| SMILES | [H]/N=N/C(CNC(=O)c1ccc(C(CCC)Sc2cc(C)c(-c3ccc(C(C)(C)C)cc3)c(C)c2)s1)/N=N/[H] |
| InChI | InChI=1S/C29H37N5OS2/c1-7-8-23(24-13-14-25(37-24)28(35)32-17-26(33-30)34-31)36-22-15-18(2)27(19(3)16-22)20-9-11-21(12-10-20)29(4,5)6/h9-16,23,26,30-31H,7-8,17H2,1-6H3,(H,32,35)/b33-30+,34-31+ |
| InChIKey | XQKAGOOCKSFHOF-MWAULZJESA-N |
| XLogP | 9.08 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.78 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|