About 1,4-dinitrosohexane
1,4-dinitrosohexane (PubChem CID 91464170) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 1,4-dinitrosohexane.
Molecular Properties
| Compound Name | 1,4-dinitrosohexane |
| PubChem CID | 91464170 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1,4-dinitrosohexane |
| SMILES | CCC(CCCN=O)N=O |
| InChI | InChI=1S/C6H12N2O2/c1-2-6(8-10)4-3-5-7-9/h6H,2-5H2,1H3 |
| InChIKey | SJTAICVYGSZSCY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dinitrosohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dinitrosohexane?
The IUPAC name of 1,4-dinitrosohexane (CID 91464170) is 1,4-dinitrosohexane.
What is the SMILES notation for 1,4-dinitrosohexane?
The canonical SMILES for 1,4-dinitrosohexane is CCC(CCCN=O)N=O.
What is the InChIKey of 1,4-dinitrosohexane?
The InChIKey is SJTAICVYGSZSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-2-6(8-10)4-3-5-7-9/h6H,2-5H2,1H3.
What are the key properties of 1,4-dinitrosohexane?
1,4-dinitrosohexane has a molecular weight of 144.17 g/mol, XLogP of 2.08, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dinitrosohexane is sourced from PubChem (CID 91464170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).