C25H47NO — CID 91464244
15-(diethylamino)-6,8,8,11,13,13-hexamethylpentadeca-5,10-dien-2-one (PubChem CID 91464244) has the molecular formula C25H47NO and a molecular weight of 377.66 g/mol. Its IUPAC name is 15-(diethylamino)-6,8,8,11,13,13-hexamethylpentadeca-5,10-dien-2-one.
| Compound Name | 15-(diethylamino)-6,8,8,11,13,13-hexamethylpentadeca-5,10-dien-2-one |
|---|---|
| PubChem CID | 91464244 |
| Molecular Formula | C25H47NO |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 377.37 |
| IUPAC Name | 15-(diethylamino)-6,8,8,11,13,13-hexamethylpentadeca-5,10-dien-2-one |
| SMILES | CCN(CC)CCC(C)(C)CC(C)=CCC(C)(C)CC(C)=CCCC(C)=O |
| InChI | InChI=1S/C25H47NO/c1-10-26(11-2)18-17-25(8,9)20-22(4)15-16-24(6,7)19-21(3)13-12-14-23(5)27/h13,15H,10-12,14,16-20H2,1-9H3 |
| InChIKey | LYTSTWREDSAYMW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|