C19H24F3N3O2 — CID 91464649
N-[2-[(5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]acetamide (PubChem CID 91464649) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[2-[(5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[(5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 91464649 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[2-[(5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1C2CC[C@H]1CC(C(N)Cc1cc(F)c(F)cc1F)C2 |
| InChI | InChI=1S/C19H24F3N3O2/c1-10(26)24-9-19(27)25-13-2-3-14(25)5-12(4-13)18(23)7-11-6-16(21)17(22)8-15(11)20/h6,8,12-14,18H,2-5,7,9,23H2,1H3,(H,24,26)/t12?,13-,14?,18?/m0/s1 |
| InChIKey | LIFLBXOUOGXAGY-YKXBYNEPSA-N |
| XLogP | 1.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|